Most of the compounds have physiologically active properties, and their biological properties are often attributed to the heteroatoms contained in their molecules, and most of these heteroatoms also appear in cyclic structures. A Journal, Inorganic Chemistry called Reactivity of [M(C∩P)(S2C-R)] (M = Pd, Pt; C∩P = CH2-C6H4-P(o-tolyl)2-κC,P; R = NMe2, OEt) toward HgX2 (X = Br, I). X-ray Crystal Structures of [Pt{CH2-C6H4P(o-tolyl)2-κC,P}(S2CNMe2)HgI(μ-I)]2 and [PdBr(S2COEt){μ-P(o-tolyl)2-C6H4-CH2-}HgBr]·0.5 HgBr2·C2H4Cl2, Author is Falvello, Larry R.; Fornies, Juan; Martin, Antonio; Navarro, Rafael; Sicilia, Violeta; Villarroya, Pablo, which mentions a compound: 172418-32-5, SMILESS is CC1=C([P]2([Pd+2]3([CH2-]C4=C2C=CC=C4)[O-]/C(C)=O[Pd+2]5([O-]/C(C)=O3)[P](C6=C(C)C=CC=C6)(C7=C([CH2-]5)C=CC=C7)C8=C(C)C=CC=C8)C9=C(C)C=CC=C9)C=CC=C1, Molecular C46H46O4P2Pd2, Category: chiral-phosphine-ligands.
The reaction of the complexes [Pt(C∩P)(S2C-R)] (C∩P = CH2-C6H4-P(o-tolyl)2-κC,P, R = NMe2, OEt) with an equimolar amount of HgX2 (X = Br, I) gives the tetranuclear derivatives [Pt(C∩P)(S2C-R)HgX(μ-X)]2 [R = NMe2, X = Br (3), I (4); R = OEt, X = Br (5), I (6)] containing Pt → Hg donor-acceptor bonds. The reaction of [Pd(C∩P)(S2CNMe2)] with HgI2 affords the complex [Pd(C∩P)(S2CNMe2)HgI(μ-I)]2 (9) similar to the complexes 3-6; by contrast the reaction of [Pd(C∩P)(S2C-R)] (R = NMe2, OEt2) with HgBr2 leads to the corresponding dinuclear complexes [PdBr(S2C-R)(μ-C∩P)HgBr] [R = NMe2 (10), OEt (11)] with the didentate C∩P cyclometalating ligand, -CH2-C6H4-P(o-tolyl)2-C,P (resulting from the C-H activation of the P(o-tolyl)3) acting in an unprecedented bridging mode. Compound 4 (C24H26HgI2NPPtS2) crystallizes in the triclinic system, space group P1̅: a = 9.5755(11) Å, b = 11.1754(12) Å, c = 14.504(2) Å, α = 84.826(5)°, β = 81.611(7)°, γ = 68.606(9)°, V = 1428.5(3) Å3, and Z = 1. Compound 11·0.5 HgBr2·C2H4Cl2 (C24H25Br2HgOPPdS2·0.5 HgBr2·C2H4Cl2) crystallizes in the monoclinic system, space group P21/c: a = 15.571(2) Å, b = 10.7425(10) Å, c = 19.655(2) Å, β = 94.741(12)°, V = 3276.5(5) Å3, and Z = 4.
Compound(172418-32-5)Category: chiral-phosphine-ligands received a lot of attention, and I have introduced some compounds in other articles, similar to this compound(trans-Di-μ-acetatobis[2-[bis(2-methylphenyl)phosphino]benzyl]dipalladium), if you are interested, you can check out my other related articles.
Reference:
Phosphine ligand,
Chiral phosphine ligands in asymmetric synthesis. Molecular structure and absolute configuration of (1,5-cyclooctadiene)-(2S,3S)-2,3-bis(diphenylphosphino)butanerhodium(I) perchlorate tetrahydrofuran solvate