Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, Recommanded Product: Tri-m-tolylphosphine, 6224-63-1, Name is Tri-m-tolylphosphine, SMILES is CC1=CC(P(C2=CC=CC(C)=C2)C3=CC=CC(C)=C3)=CC=C1, belongs to chiral-phosphine-ligands compound. In a document, author is Qian, Chenxiao, introduce the new discover.
Phosphine-Catalyzed Enantioselective [1+4] Annulation of Morita-Baylis-Hillman Carbonates with alpha,beta-Unsaturated Imines
This work describes a phosphine-mediated enantioselective [1+4] annulation of Morita-Baylis-Hillman carbonates with alpha,beta-unsaturated imines. In the presence of 1,2-bis[(2R,5R)-2,5-dimethylphospholano]-benzene monoxide, Morita-Baylis-Hillman carbonates react with alpha,beta-unsaturated imines smoothly to furnish a series of chiral 2-pyrrolines in moderate to high yields with excellent diastereo- and enantioselectivities (all d.r. values >20 : 1, in most cases >90% ee). Importantly, a large number of alpha,beta-unsaturated imines with different substituents on either the nitrogen atom or the aromatic ring is compatible, offering a facile synthetic approach to the enantiomers of reported enantiopure 2-pyrrolines.
A reaction mechanism is the microscopic path by which reactants are transformed into products. Each step is an elementary reaction. In my other articles, you can also check out more blogs about 6224-63-1. Recommanded Product: Tri-m-tolylphosphine.
Reference:
Phosphine ligand,
,Chiral phosphine ligands in asymmetric synthesis. Molecular structure and absolute configuration of (1,5-cyclooctadiene)-(2S,3S)-2,3-bis(diphenylphosphino)butanerhodium(I) perchlorate tetrahydrofuran solvate