Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 6372-42-5, Name is Cyclohexyldiphenylphosphine, SMILES is C1CCC(CC1)P(C1=CC=CC=C1)C1=CC=CC=C1, belongs to chiral-phosphine-ligands compound. In a document, author is Zhang, Yaqi, introduce the new discover, Name: Cyclohexyldiphenylphosphine.
Enantioselective Syntheses of Axially Chiral Phosphonates or Phosphine Oxides via Asymmetric Suzuki Reactions with Chiral Sulfinamide Monophosphine Ligands
A class of chiral sulfinamide monophosphine ligands Ming-Phos were firstly employed in the asymmetric Suzuki coupling reactions. Using the in-situ formed catalyst from PdCl2 and (R, S-S)-M07, 22 axially chiral phosphonates or phosphine oxides were successfully synthesized in 29-99% yields with up to 98% ee. This method provides a simple and efficient protocol for the synthesis of axially chiral biaryl monophosphine oxides.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 6372-42-5 is helpful to your research. Name: Cyclohexyldiphenylphosphine.
Reference:
Phosphine ligand,
,Chiral phosphine ligands in asymmetric synthesis. Molecular structure and absolute configuration of (1,5-cyclooctadiene)-(2S,3S)-2,3-bis(diphenylphosphino)butanerhodium(I) perchlorate tetrahydrofuran solvate