Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, SDS of cas: 1486-28-8, 1486-28-8, Name is Methyldiphenylphosphine, SMILES is CP(C1=CC=CC=C1)C2=CC=CC=C2, belongs to chiral-phosphine-ligands compound. In a document, author is Wong, Esther Hui Yen, introduce the new discover.
Catalytic asymmetric synthesis of Pt- and Pd-PCP pincer complexes bearing a para-N pyridinyl backbone
A diastereoselective catalytic asymmetric hydrophosphination reaction was performed using a palladacycle catalyst to produce chiral PCP phosphine ligand with high dr (95: 5) and excellent enantioselectivity (>99% ee). Subsequent facile metalation of the chiral ligand with Pt and Pd metal salts yielded the desired pincer complexes. The protonated form of these pincer complexes was also synthesised, and their structures were confirmed through the use of X-ray crystal diffraction and NMR spectroscopy analyses. (C) 2018 Elsevier B.V. All rights reserved.
A reaction mechanism is the microscopic path by which reactants are transformed into products. Each step is an elementary reaction. In my other articles, you can also check out more blogs about 1486-28-8. SDS of cas: 1486-28-8.
Reference:
Phosphine ligand,
,Chiral phosphine ligands in asymmetric synthesis. Molecular structure and absolute configuration of (1,5-cyclooctadiene)-(2S,3S)-2,3-bis(diphenylphosphino)butanerhodium(I) perchlorate tetrahydrofuran solvate