Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 1486-28-8, Name is Methyldiphenylphosphine, SMILES is CP(C1=CC=CC=C1)C2=CC=CC=C2, belongs to chiral-phosphine-ligands compound. In a document, author is Tan, Xiangyu, introduce the new discover, SDS of cas: 1486-28-8.
Phosphine oxide-Sc(OTf)(3) catalyzed enantioselective bromoaminocyclization of tri-substituted allyl N-tosylcarbamates
Phosphine oxide-Sc(OTf)(3) catalyzed regio- and enantioselective bromoaminocyclization of tri-substituted allyl N-tosylcarbamates is described. A wide variety of optically active tertiary 5-bromo-1,3-oxazinan-2-ones can be obtained with high regio-and enantioselectivity.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 1486-28-8 is helpful to your research. SDS of cas: 1486-28-8.
Reference:
Phosphine ligand,
,Chiral phosphine ligands in asymmetric synthesis. Molecular structure and absolute configuration of (1,5-cyclooctadiene)-(2S,3S)-2,3-bis(diphenylphosphino)butanerhodium(I) perchlorate tetrahydrofuran solvate