Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 7650-91-1, Name is Benzyldiphenylphosphine, SMILES is P(C1=CC=CC=C1)(CC2=CC=CC=C2)C3=CC=CC=C3, belongs to chiral-phosphine-ligands compound. In a document, author is Iwanejko, Jakub, introduce the new discover, Safety of Benzyldiphenylphosphine.
Hydrophosphonylation of chiral hexahydroquinoxalin-2(1H)-one derivatives as an effective route to new bicyclic compounds: Aminophosphonates, enamines and imines
A series of new aminophosphonate and phosphonic acid derivatives of hexahydroquinoxalin-2(1H)-ones and tetrahydroquinoxalin-2(1H)-ones were synthesised via hydrophosphonylation of the corresponding bicyclic imines with various dialkyl or diaryl H-phosphonates, H-phosphinates or H-phosphine oxides as phosphorus nucleophiles. The utility of the obtained compounds was demonstrated by their application as a source of phosphonate carbanion in the Horner-Wadsworth-Emmons (HWE) reaction leading to new bicyclic amines with an exocyclic, and unexpectedly, also endocyclic double bond depending on the structure of the aldehyde used. (C) 2019 Elsevier Ltd. All rights reserved.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 7650-91-1 is helpful to your research. Safety of Benzyldiphenylphosphine.
Reference:
Phosphine ligand,
,Chiral phosphine ligands in asymmetric synthesis. Molecular structure and absolute configuration of (1,5-cyclooctadiene)-(2S,3S)-2,3-bis(diphenylphosphino)butanerhodium(I) perchlorate tetrahydrofuran solvate